C31H48O7 — CID 70923087
(1R,2R)-3-(2,4-dibutoxy-6-hydroxyphenyl)-1-(3,4-dibutoxyphenyl)propane-1,2-diol (PubChem CID 70923087) has the molecular formula C31H48O7 and a molecular weight of 532.72 g/mol. Its IUPAC name is (1R,2R)-3-(2,4-dibutoxy-6-hydroxyphenyl)-1-(3,4-dibutoxyphenyl)propane-1,2-diol.
| Compound Name | (1R,2R)-3-(2,4-dibutoxy-6-hydroxyphenyl)-1-(3,4-dibutoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 70923087 |
| Molecular Formula | C31H48O7 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | (1R,2R)-3-(2,4-dibutoxy-6-hydroxyphenyl)-1-(3,4-dibutoxyphenyl)propane-1,2-diol |
| SMILES | CCCCOc1cc(O)c(C[C@@H](O)[C@H](O)c2ccc(OCCCC)c(OCCCC)c2)c(OCCCC)c1 |
| InChI | InChI=1S/C31H48O7/c1-5-9-15-35-24-20-26(32)25(29(21-24)37-17-11-7-3)22-27(33)31(34)23-13-14-28(36-16-10-6-2)30(19-23)38-18-12-8-4/h13-14,19-21,27,31-34H,5-12,15-18,22H2,1-4H3/t27-,31-/m1/s1 |
| InChIKey | CYZKCFPVKVXMJH-DLFZDVPBSA-N |
| XLogP | 6.74 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|