C29H34N2O — CID 70925220
[(2S)-2-[[ethyl(propyl)amino]methyl]pyrrolidin-1-yl]-[4-(3-phenylphenyl)phenyl]methanone (PubChem CID 70925220) has the molecular formula C29H34N2O and a molecular weight of 426.60 g/mol. Its IUPAC name is [(2S)-2-[[ethyl(propyl)amino]methyl]pyrrolidin-1-yl]-[4-(3-phenylphenyl)phenyl]methanone.
| Compound Name | [(2S)-2-[[ethyl(propyl)amino]methyl]pyrrolidin-1-yl]-[4-(3-phenylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 70925220 |
| Molecular Formula | C29H34N2O |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | [(2S)-2-[[ethyl(propyl)amino]methyl]pyrrolidin-1-yl]-[4-(3-phenylphenyl)phenyl]methanone |
| SMILES | CCCN(CC)C[C@@H]1CCCN1C(=O)c1ccc(-c2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H34N2O/c1-3-19-30(4-2)22-28-14-9-20-31(28)29(32)25-17-15-24(16-18-25)27-13-8-12-26(21-27)23-10-6-5-7-11-23/h5-8,10-13,15-18,21,28H,3-4,9,14,19-20,22H2,1-2H3/t28-/m0/s1 |
| InChIKey | SUFQZZPOCCDIQX-NDEPHWFRSA-N |
| XLogP | 6.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |