C23H36N2O4 — CID 70946551
methyl 5-[4-[2-[[ethyl(propyl)amino]methyl]pyrrolidine-1-carbonyl]phenoxy]pentanoate (PubChem CID 70946551) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is methyl 5-[4-[2-[[ethyl(propyl)amino]methyl]pyrrolidine-1-carbonyl]phenoxy]pentanoate.
| Compound Name | methyl 5-[4-[2-[[ethyl(propyl)amino]methyl]pyrrolidine-1-carbonyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 70946551 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | methyl 5-[4-[2-[[ethyl(propyl)amino]methyl]pyrrolidine-1-carbonyl]phenoxy]pentanoate |
| SMILES | CCCN(CC)CC1CCCN1C(=O)c1ccc(OCCCCC(=O)OC)cc1 |
| InChI | InChI=1S/C23H36N2O4/c1-4-15-24(5-2)18-20-9-8-16-25(20)23(27)19-11-13-21(14-12-19)29-17-7-6-10-22(26)28-3/h11-14,20H,4-10,15-18H2,1-3H3 |
| InChIKey | VUVPCRPIYHHYKS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|