C25H20BrNO2 — CID 70929133
2-(7-bromo-9,9-diethylfluoren-2-yl)isoindole-1,3-dione (PubChem CID 70929133) has the molecular formula C25H20BrNO2 and a molecular weight of 446.34 g/mol. Its IUPAC name is 2-(7-bromo-9,9-diethylfluoren-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(7-bromo-9,9-diethylfluoren-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 70929133 |
| Molecular Formula | C25H20BrNO2 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-(7-bromo-9,9-diethylfluoren-2-yl)isoindole-1,3-dione |
| SMILES | CCC1(CC)c2cc(Br)ccc2-c2ccc(N3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C25H20BrNO2/c1-3-25(4-2)21-13-15(26)9-11-17(21)18-12-10-16(14-22(18)25)27-23(28)19-7-5-6-8-20(19)24(27)29/h5-14H,3-4H2,1-2H3 |
| InChIKey | UBGIIHQROIBLAH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|