C18H28N4 — CID 70929908
5-N-(4-heptylphenyl)-3-N,3-N-dimethyl-1H-pyrazole-3,5-diamine (PubChem CID 70929908) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 5-N-(4-heptylphenyl)-3-N,3-N-dimethyl-1H-pyrazole-3,5-diamine.
| Compound Name | 5-N-(4-heptylphenyl)-3-N,3-N-dimethyl-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 70929908 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 5-N-(4-heptylphenyl)-3-N,3-N-dimethyl-1H-pyrazole-3,5-diamine |
| SMILES | CCCCCCCc1ccc(Nc2cc(N(C)C)n[nH]2)cc1 |
| InChI | InChI=1S/C18H28N4/c1-4-5-6-7-8-9-15-10-12-16(13-11-15)19-17-14-18(21-20-17)22(2)3/h10-14H,4-9H2,1-3H3,(H2,19,20,21) |
| InChIKey | KDPCHMXFQGPXIU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|