C19H24F3N7 — CID 70929943
6-piperidin-1-yl-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-4-amine (PubChem CID 70929943) has the molecular formula C19H24F3N7 and a molecular weight of 407.44 g/mol. Its IUPAC name is 6-piperidin-1-yl-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | 6-piperidin-1-yl-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 70929943 |
| Molecular Formula | C19H24F3N7 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 6-piperidin-1-yl-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrimidin-4-amine |
| SMILES | Nc1cc(N2CCCCC2)nc(N2CCN(c3ncccc3C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C19H24F3N7/c20-19(21,22)14-5-4-6-24-17(14)28-9-11-29(12-10-28)18-25-15(23)13-16(26-18)27-7-2-1-3-8-27/h4-6,13H,1-3,7-12H2,(H2,23,25,26) |
| InChIKey | BQFURUSXRQJFRT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |