C26H33N3O5 — CID 70930397
(Z)-3-[[4-[(2S)-2-[hydroxy-bis(4-methoxyphenyl)methyl]pyrrolidin-1-yl]-4-oxobutyl]amino]prop-2-enamide (PubChem CID 70930397) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is (Z)-3-[[4-[(2S)-2-[hydroxy-bis(4-methoxyphenyl)methyl]pyrrolidin-1-yl]-4-oxobutyl]amino]prop-2-enamide.
| Compound Name | (Z)-3-[[4-[(2S)-2-[hydroxy-bis(4-methoxyphenyl)methyl]pyrrolidin-1-yl]-4-oxobutyl]amino]prop-2-enamide |
|---|---|
| PubChem CID | 70930397 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | (Z)-3-[[4-[(2S)-2-[hydroxy-bis(4-methoxyphenyl)methyl]pyrrolidin-1-yl]-4-oxobutyl]amino]prop-2-enamide |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)[C@@H]2CCCN2C(=O)CCCN/C=C\C(N)=O)cc1 |
| InChI | InChI=1S/C26H33N3O5/c1-33-21-11-7-19(8-12-21)26(32,20-9-13-22(34-2)14-10-20)23-5-4-18-29(23)25(31)6-3-16-28-17-15-24(27)30/h7-15,17,23,28,32H,3-6,16,18H2,1-2H3,(H2,27,30)/b17-15-/t23-/m0/s1 |
| InChIKey | KBHQKZUKOWJEMM-ZBORUMQWSA-N |
| XLogP | 2.30 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|