C21H18N2O2S — CID 70930832
2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-N-(1-phenylethyl)-1,3-thiazole-5-carboxamide (PubChem CID 70930832) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-N-(1-phenylethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-N-(1-phenylethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 70930832 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-[2-(4-hydroxyphenyl)ethynyl]-4-methyl-N-(1-phenylethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C#Cc2ccc(O)cc2)sc1C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O2S/c1-14(17-6-4-3-5-7-17)23-21(25)20-15(2)22-19(26-20)13-10-16-8-11-18(24)12-9-16/h3-9,11-12,14,24H,1-2H3,(H,23,25) |
| InChIKey | OGFNHIZGGWGQBO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|