C13H19Cl3O5 — CID 70933082
4-O-ethyl 3-O-(trichloromethyl) 2,5-diethyloxolane-3,4-dicarboxylate (PubChem CID 70933082) has the molecular formula C13H19Cl3O5 and a molecular weight of 361.65 g/mol. Its IUPAC name is 4-O-ethyl 3-O-(trichloromethyl) 2,5-diethyloxolane-3,4-dicarboxylate.
| Compound Name | 4-O-ethyl 3-O-(trichloromethyl) 2,5-diethyloxolane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 70933082 |
| Molecular Formula | C13H19Cl3O5 |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 4-O-ethyl 3-O-(trichloromethyl) 2,5-diethyloxolane-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1C(CC)OC(CC)C1C(=O)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H19Cl3O5/c1-4-7-9(11(17)19-6-3)10(8(5-2)20-7)12(18)21-13(14,15)16/h7-10H,4-6H2,1-3H3 |
| InChIKey | JYLVQZCSIXVMJG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|