C20H27N3O2 — CID 70933158
1-(hydroxymethyl)-7-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]naphthalen-2-ol (PubChem CID 70933158) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-(hydroxymethyl)-7-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]naphthalen-2-ol.
| Compound Name | 1-(hydroxymethyl)-7-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 70933158 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-(hydroxymethyl)-7-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]naphthalen-2-ol |
| SMILES | CN1CCN(C2CCN(c3ccc4ccc(O)c(CO)c4c3)C2)CC1 |
| InChI | InChI=1S/C20H27N3O2/c1-21-8-10-22(11-9-21)17-6-7-23(13-17)16-4-2-15-3-5-20(25)19(14-24)18(15)12-16/h2-5,12,17,24-25H,6-11,13-14H2,1H3 |
| InChIKey | JXAVQQFAFDLNKR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |