C31H30ClN7O3 — CID 70934190
2-(3-chloro-4-piperazin-1-ylanilino)-6-[2-methyl-4-(1,3-oxazol-4-yl)phenyl]-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 70934190) has the molecular formula C31H30ClN7O3 and a molecular weight of 584.08 g/mol. Its IUPAC name is 2-(3-chloro-4-piperazin-1-ylanilino)-6-[2-methyl-4-(1,3-oxazol-4-yl)phenyl]-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(3-chloro-4-piperazin-1-ylanilino)-6-[2-methyl-4-(1,3-oxazol-4-yl)phenyl]-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 70934190 |
| Molecular Formula | C31H30ClN7O3 |
| Molecular Weight | 584.08 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | 2-(3-chloro-4-piperazin-1-ylanilino)-6-[2-methyl-4-(1,3-oxazol-4-yl)phenyl]-8-(oxolan-3-yl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(-c2cocn2)ccc1-c1cc2cnc(Nc3ccc(N4CCNCC4)c(Cl)c3)nc2n(C2CCOC2)c1=O |
| InChI | InChI=1S/C31H30ClN7O3/c1-19-12-20(27-17-42-18-35-27)2-4-24(19)25-13-21-15-34-31(37-29(21)39(30(25)40)23-6-11-41-16-23)36-22-3-5-28(26(32)14-22)38-9-7-33-8-10-38/h2-5,12-15,17-18,23,33H,6-11,16H2,1H3,(H,34,36,37) |
| InChIKey | XXEAPLNCOSQVIC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.08 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|