C20H21FN2O — CID 70938127
(3S,3aS,7aS)-3-[5-(3-fluorophenyl)-2-pyridinyl]-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one (PubChem CID 70938127) has the molecular formula C20H21FN2O and a molecular weight of 324.40 g/mol. Its IUPAC name is (3S,3aS,7aS)-3-[5-(3-fluorophenyl)-2-pyridinyl]-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one.
| Compound Name | (3S,3aS,7aS)-3-[5-(3-fluorophenyl)-2-pyridinyl]-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
|---|---|
| PubChem CID | 70938127 |
| Molecular Formula | C20H21FN2O |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (3S,3aS,7aS)-3-[5-(3-fluorophenyl)-2-pyridinyl]-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-indol-2-one |
| SMILES | CN1C(=O)[C@H](c2ccc(-c3cccc(F)c3)cn2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C20H21FN2O/c1-23-18-8-3-2-7-16(18)19(20(23)24)17-10-9-14(12-22-17)13-5-4-6-15(21)11-13/h4-6,9-12,16,18-19H,2-3,7-8H2,1H3/t16-,18+,19+/m1/s1 |
| InChIKey | IZWSZJAUJWGPJH-NEWSRXKRSA-N |
| XLogP | 4.00 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |