C25H28FN3 — CID 143653790
(Z)-[(3Z)-3-(aminomethylidene)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ylidene]methanamine (PubChem CID 143653790) has the molecular formula C25H28FN3 and a molecular weight of 389.52 g/mol. Its IUPAC name is (Z)-[(3Z)-3-(aminomethylidene)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ylidene]methanamine.
| Compound Name | (Z)-[(3Z)-3-(aminomethylidene)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ylidene]methanamine |
|---|---|
| PubChem CID | 143653790 |
| Molecular Formula | C25H28FN3 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | (Z)-[(3Z)-3-(aminomethylidene)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ylidene]methanamine |
| SMILES | N/C=C1/CC2CCCCC2C(/C=C/c2ccc(-c3cccc(F)c3)cn2)/C1=C/N |
| InChI | InChI=1S/C25H28FN3/c26-21-6-3-5-17(13-21)19-8-9-22(29-16-19)10-11-24-23-7-2-1-4-18(23)12-20(14-27)25(24)15-28/h3,5-6,8-11,13-16,18,23-24H,1-2,4,7,12,27-28H2/b11-10+,20-14-,25-15+ |
| InChIKey | HOWNIGMKKGBKEA-ZNAYREDVSA-N |
| XLogP | 5.41 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |