C27H26FN3O2 — CID 87202516
N-[(5aR,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-oxo-5,5a,6,7,8,9,9a,10-octahydro-2H-benzo[g]isoquinolin-7-yl]formamide (PubChem CID 87202516) has the molecular formula C27H26FN3O2 and a molecular weight of 443.52 g/mol. Its IUPAC name is N-[(5aR,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-oxo-5,5a,6,7,8,9,9a,10-octahydro-2H-benzo[g]isoquinolin-7-yl]formamide.
| Compound Name | N-[(5aR,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-oxo-5,5a,6,7,8,9,9a,10-octahydro-2H-benzo[g]isoquinolin-7-yl]formamide |
|---|---|
| PubChem CID | 87202516 |
| Molecular Formula | C27H26FN3O2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-[(5aR,7R,9aR,10S)-10-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-oxo-5,5a,6,7,8,9,9a,10-octahydro-2H-benzo[g]isoquinolin-7-yl]formamide |
| SMILES | O=CN[C@@H]1CC[C@@H]2[C@H](Cc3cc(=O)[nH]cc3[C@H]2/C=C/c2ccc(-c3cccc(F)c3)cn2)C1 |
| InChI | InChI=1S/C27H26FN3O2/c28-21-3-1-2-17(11-21)18-4-5-22(29-14-18)6-9-25-24-8-7-23(31-16-32)12-19(24)10-20-13-27(33)30-15-26(20)25/h1-6,9,11,13-16,19,23-25H,7-8,10,12H2,(H,30,33)(H,31,32)/b9-6+/t19-,23-,24-,25+/m1/s1 |
| InChIKey | OFHFFZAJBGZMOH-AXJAAKCKSA-N |
| XLogP | 4.46 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|