C27H35FN2O2 — CID 145386408
(8aS)-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one;2-ethenyl-5-(3-fluorophenyl)pyridine;methanamine (PubChem CID 145386408) has the molecular formula C27H35FN2O2 and a molecular weight of 438.59 g/mol. Its IUPAC name is (8aS)-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one;2-ethenyl-5-(3-fluorophenyl)pyridine;methanamine.
| Compound Name | (8aS)-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one;2-ethenyl-5-(3-fluorophenyl)pyridine;methanamine |
|---|---|
| PubChem CID | 145386408 |
| Molecular Formula | C27H35FN2O2 |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (8aS)-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one;2-ethenyl-5-(3-fluorophenyl)pyridine;methanamine |
| SMILES | C=Cc1ccc(-c2cccc(F)c2)cn1.CC1OC(=O)C2CC3CCCC[C@H]3CC12.CN |
| InChI | InChI=1S/C13H10FN.C13H20O2.CH5N/c1-2-13-7-6-11(9-15-13)10-4-3-5-12(14)8-10;1-8-11-6-9-4-2-3-5-10(9)7-12(11)13(14)15-8;1-2/h2-9H,1H2;8-12H,2-7H2,1H3;2H2,1H3/t;8?,9-,10?,11?,12?;/m.0./s1 |
| InChIKey | HLECXXOKAAVMIA-QEFGGFRVSA-N |
| XLogP | 5.87 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |