C58H51N5O2 — CID 70938513
[4-(N-[4-[4-[4-(N-(4-methoxy-2-methylphenyl)-4-phenylanilino)phenyl]phenyl]phenyl]-4-phenylanilino)-3-methylphenoxy]methanetriamine (PubChem CID 70938513) has the molecular formula C58H51N5O2 and a molecular weight of 850.08 g/mol. Its IUPAC name is [4-(N-[4-[4-[4-(N-(4-methoxy-2-methylphenyl)-4-phenylanilino)phenyl]phenyl]phenyl]-4-phenylanilino)-3-methylphenoxy]methanetriamine.
| Compound Name | [4-(N-[4-[4-[4-(N-(4-methoxy-2-methylphenyl)-4-phenylanilino)phenyl]phenyl]phenyl]-4-phenylanilino)-3-methylphenoxy]methanetriamine |
|---|---|
| PubChem CID | 70938513 |
| Molecular Formula | C58H51N5O2 |
| Molecular Weight | 850.08 g/mol |
| Exact Mass | 849.40 |
| IUPAC Name | [4-(N-[4-[4-[4-(N-(4-methoxy-2-methylphenyl)-4-phenylanilino)phenyl]phenyl]phenyl]-4-phenylanilino)-3-methylphenoxy]methanetriamine |
| SMILES | COc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5ccc(OC(N)(N)N)cc5C)cc4)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C58H51N5O2/c1-40-38-54(64-3)34-36-56(40)62(50-26-18-46(19-27-50)42-10-6-4-7-11-42)52-30-22-48(23-31-52)44-14-16-45(17-15-44)49-24-32-53(33-25-49)63(57-37-35-55(39-41(57)2)65-58(59,60)61)51-28-20-47(21-29-51)43-12-8-5-9-13-43/h4-39H,59-61H2,1-3H3 |
| InChIKey | KEDIFNXCLBWUDZ-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.08 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|