C24H27NO3 — CID 18996715
4-(2-ethoxyethoxy)-N-(4-methoxyphenyl)-2-methyl-N-phenylaniline (PubChem CID 18996715) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 4-(2-ethoxyethoxy)-N-(4-methoxyphenyl)-2-methyl-N-phenylaniline.
| Compound Name | 4-(2-ethoxyethoxy)-N-(4-methoxyphenyl)-2-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 18996715 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4-(2-ethoxyethoxy)-N-(4-methoxyphenyl)-2-methyl-N-phenylaniline |
| SMILES | CCOCCOc1ccc(N(c2ccccc2)c2ccc(OC)cc2)c(C)c1 |
| InChI | InChI=1S/C24H27NO3/c1-4-27-16-17-28-23-14-15-24(19(2)18-23)25(20-8-6-5-7-9-20)21-10-12-22(26-3)13-11-21/h5-15,18H,4,16-17H2,1-3H3 |
| InChIKey | FXWNDBMMTJHDRK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|