C22H30FN3O3 — CID 70940378
3-fluoro-5-methoxy-N-[[4-[2-[(1-methylcyclobutyl)amino]-2-oxoethyl]iminocyclohexyl]methyl]benzamide (PubChem CID 70940378) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is 3-fluoro-5-methoxy-N-[[4-[2-[(1-methylcyclobutyl)amino]-2-oxoethyl]iminocyclohexyl]methyl]benzamide.
| Compound Name | 3-fluoro-5-methoxy-N-[[4-[2-[(1-methylcyclobutyl)amino]-2-oxoethyl]iminocyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 70940378 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 3-fluoro-5-methoxy-N-[[4-[2-[(1-methylcyclobutyl)amino]-2-oxoethyl]iminocyclohexyl]methyl]benzamide |
| SMILES | COc1cc(F)cc(C(=O)NCC2CCC(=NCC(=O)NC3(C)CCC3)CC2)c1 |
| InChI | InChI=1S/C22H30FN3O3/c1-22(8-3-9-22)26-20(27)14-24-18-6-4-15(5-7-18)13-25-21(28)16-10-17(23)12-19(11-16)29-2/h10-12,15H,3-9,13-14H2,1-2H3,(H,25,28)(H,26,27)/b24-18- |
| InChIKey | JGKBHYYVDLLSCQ-MOHJPFBDSA-N |
| XLogP | 3.25 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|