C11H14N2O3S — CID 70941012
1-(2-hydroxy-2-thiophen-2-ylacetyl)pyrrolidine-2-carboxamide (PubChem CID 70941012) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 1-(2-hydroxy-2-thiophen-2-ylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-hydroxy-2-thiophen-2-ylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70941012 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-(2-hydroxy-2-thiophen-2-ylacetyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)C(O)c1cccs1 |
| InChI | InChI=1S/C11H14N2O3S/c12-10(15)7-3-1-5-13(7)11(16)9(14)8-4-2-6-17-8/h2,4,6-7,9,14H,1,3,5H2,(H2,12,15) |
| InChIKey | PHINYIQPAOTQGO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |