C18H23N5O4S — CID 70944299
tert-butyl N-amino-N-[5-(4-methylphenyl)sulfonyl-6,7-dihydropyrrolo[2,3-b]pyrazin-2-yl]carbamate (PubChem CID 70944299) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is tert-butyl N-amino-N-[5-(4-methylphenyl)sulfonyl-6,7-dihydropyrrolo[2,3-b]pyrazin-2-yl]carbamate.
| Compound Name | tert-butyl N-amino-N-[5-(4-methylphenyl)sulfonyl-6,7-dihydropyrrolo[2,3-b]pyrazin-2-yl]carbamate |
|---|---|
| PubChem CID | 70944299 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | tert-butyl N-amino-N-[5-(4-methylphenyl)sulfonyl-6,7-dihydropyrrolo[2,3-b]pyrazin-2-yl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3nc(N(N)C(=O)OC(C)(C)C)cnc32)cc1 |
| InChI | InChI=1S/C18H23N5O4S/c1-12-5-7-13(8-6-12)28(25,26)22-10-9-14-16(22)20-11-15(21-14)23(19)17(24)27-18(2,3)4/h5-8,11H,9-10,19H2,1-4H3 |
| InChIKey | GDAFURCOGBYHCF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|