About 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine
5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine (PubChem CID 89122773) has the molecular formula C21H19N3O2S
and a molecular weight of 377.47 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine |
| PubChem CID | 89122773 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3nc(/C=C/c4ccccc4)cnc32)cc1 |
| InChI | InChI=1S/C21H19N3O2S/c1-16-7-11-19(12-8-16)27(25,26)24-14-13-20-21(24)22-15-18(23-20)10-9-17-5-3-2-4-6-17/h2-12,15H,13-14H2,1H3/b10-9+ |
| InChIKey | AMEKHTLTMJEPQP-MDZDMXLPSA-N |
| XLogP | 3.71 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine?
The IUPAC name of 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine (CID 89122773) is 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine?
The canonical SMILES for 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine is Cc1ccc(S(=O)(=O)N2CCc3nc(/C=C/c4ccccc4)cnc32)cc1.
What is the InChIKey of 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine?
The InChIKey is AMEKHTLTMJEPQP-MDZDMXLPSA-N. The full InChI is InChI=1S/C21H19N3O2S/c1-16-7-11-19(12-8-16)27(25,26)24-14-13-20-21(24)22-15-18(23-20)10-9-17-5-3-2-4-6-17/h2-12,15H,13-14H2,1H3/b10-9+.
What are the key properties of 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine?
5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine has a molecular weight of 377.47 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylphenyl)sulfonyl-2-[(E)-2-phenylethenyl]-6,7-dihydropyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 89122773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).