C13H11IN2O2S — CID 67961663
1-(benzenesulfonyl)-5-iodo-2,3-dihydropyrrolo[2,3-b]pyridine (PubChem CID 67961663) has the molecular formula C13H11IN2O2S and a molecular weight of 386.21 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-iodo-2,3-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-5-iodo-2,3-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 67961663 |
| Molecular Formula | C13H11IN2O2S |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 1-(benzenesulfonyl)-5-iodo-2,3-dihydropyrrolo[2,3-b]pyridine |
| SMILES | O=S(=O)(c1ccccc1)N1CCc2cc(I)cnc21 |
| InChI | InChI=1S/C13H11IN2O2S/c14-11-8-10-6-7-16(13(10)15-9-11)19(17,18)12-4-2-1-3-5-12/h1-5,8-9H,6-7H2 |
| InChIKey | LEKDAPMMKHYLBG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|