C17H16N2O3S — CID 123305207
4-[1-(benzenesulfonyl)-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]but-3-en-2-one (PubChem CID 123305207) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 4-[1-(benzenesulfonyl)-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]but-3-en-2-one.
| Compound Name | 4-[1-(benzenesulfonyl)-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 123305207 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-[1-(benzenesulfonyl)-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]but-3-en-2-one |
| SMILES | CC(=O)C=Cc1cnc2c(c1)CCN2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O3S/c1-13(20)7-8-14-11-15-9-10-19(17(15)18-12-14)23(21,22)16-5-3-2-4-6-16/h2-8,11-12H,9-10H2,1H3 |
| InChIKey | NOPJKFMSSQKSDX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|