C17H16N2O4S — CID 123716885
methyl 3-[1-(benzenesulfonyl)-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]prop-2-enoate (PubChem CID 123716885) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl 3-[1-(benzenesulfonyl)-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]prop-2-enoate.
| Compound Name | methyl 3-[1-(benzenesulfonyl)-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 123716885 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | methyl 3-[1-(benzenesulfonyl)-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cnc2c(c1)CCN2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O4S/c1-23-16(20)8-7-13-11-14-9-10-19(17(14)18-12-13)24(21,22)15-5-3-2-4-6-15/h2-8,11-12H,9-10H2,1H3 |
| InChIKey | OIPYXSIBKOXAJQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|