C25H19N5O3S — CID 70947401
1-hydroxy-N-(2-methoxyphenyl)-4-(1-phenyltetrazol-5-yl)sulfanylnaphthalene-2-carboxamide (PubChem CID 70947401) has the molecular formula C25H19N5O3S and a molecular weight of 469.53 g/mol. Its IUPAC name is 1-hydroxy-N-(2-methoxyphenyl)-4-(1-phenyltetrazol-5-yl)sulfanylnaphthalene-2-carboxamide.
| Compound Name | 1-hydroxy-N-(2-methoxyphenyl)-4-(1-phenyltetrazol-5-yl)sulfanylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 70947401 |
| Molecular Formula | C25H19N5O3S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 1-hydroxy-N-(2-methoxyphenyl)-4-(1-phenyltetrazol-5-yl)sulfanylnaphthalene-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1cc(Sc2nnnn2-c2ccccc2)c2ccccc2c1O |
| InChI | InChI=1S/C25H19N5O3S/c1-33-21-14-8-7-13-20(21)26-24(32)19-15-22(17-11-5-6-12-18(17)23(19)31)34-25-27-28-29-30(25)16-9-3-2-4-10-16/h2-15,31H,1H3,(H,26,32) |
| InChIKey | QFDMYDGYOCRTDC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |