C16H16N6O2S — CID 20678328
N'-(2-methoxyphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetohydrazide (PubChem CID 20678328) has the molecular formula C16H16N6O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetohydrazide.
| Compound Name | N'-(2-methoxyphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 20678328 |
| Molecular Formula | C16H16N6O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N'-(2-methoxyphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetohydrazide |
| SMILES | COc1ccccc1NNC(=O)CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C16H16N6O2S/c1-24-14-10-6-5-9-13(14)17-18-15(23)11-25-16-19-20-21-22(16)12-7-3-2-4-8-12/h2-10,17H,11H2,1H3,(H,18,23) |
| InChIKey | GIUBUCAJTMBPOL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|