C35H31N7O6S — CID 59940361
1-hydroxy-N-(2-methylphenyl)-4-[4-nitro-2-[[(1-phenyltetrazol-5-yl)sulfanyloxy-propan-2-ylamino]methyl]phenoxy]naphthalene-2-carboxamide (PubChem CID 59940361) has the molecular formula C35H31N7O6S and a molecular weight of 677.74 g/mol. Its IUPAC name is 1-hydroxy-N-(2-methylphenyl)-4-[4-nitro-2-[[(1-phenyltetrazol-5-yl)sulfanyloxy-propan-2-ylamino]methyl]phenoxy]naphthalene-2-carboxamide.
| Compound Name | 1-hydroxy-N-(2-methylphenyl)-4-[4-nitro-2-[[(1-phenyltetrazol-5-yl)sulfanyloxy-propan-2-ylamino]methyl]phenoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 59940361 |
| Molecular Formula | C35H31N7O6S |
| Molecular Weight | 677.74 g/mol |
| Exact Mass | 677.21 |
| IUPAC Name | 1-hydroxy-N-(2-methylphenyl)-4-[4-nitro-2-[[(1-phenyltetrazol-5-yl)sulfanyloxy-propan-2-ylamino]methyl]phenoxy]naphthalene-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1cc(Oc2ccc([N+](=O)[O-])cc2CN(OSc2nnnn2-c2ccccc2)C(C)C)c2ccccc2c1O |
| InChI | InChI=1S/C35H31N7O6S/c1-22(2)40(48-49-35-37-38-39-41(35)25-12-5-4-6-13-25)21-24-19-26(42(45)46)17-18-31(24)47-32-20-29(33(43)28-15-9-8-14-27(28)32)34(44)36-30-16-10-7-11-23(30)3/h4-20,22,43H,21H2,1-3H3,(H,36,44) |
| InChIKey | KGSUYVHEZKSETA-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.74 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|