C30H29N7O7S2 — CID 22955813
S-(1-phenyltetrazol-5-yl) N-[[2-[furan-2-yl-[4-(methanesulfonamido)phenyl]methoxy]-5-nitrophenyl]methyl]-N-propan-2-ylcarbamothioate (PubChem CID 22955813) has the molecular formula C30H29N7O7S2 and a molecular weight of 663.74 g/mol. Its IUPAC name is S-(1-phenyltetrazol-5-yl) N-[[2-[furan-2-yl-[4-(methanesulfonamido)phenyl]methoxy]-5-nitrophenyl]methyl]-N-propan-2-ylcarbamothioate.
| Compound Name | S-(1-phenyltetrazol-5-yl) N-[[2-[furan-2-yl-[4-(methanesulfonamido)phenyl]methoxy]-5-nitrophenyl]methyl]-N-propan-2-ylcarbamothioate |
|---|---|
| PubChem CID | 22955813 |
| Molecular Formula | C30H29N7O7S2 |
| Molecular Weight | 663.74 g/mol |
| Exact Mass | 663.16 |
| IUPAC Name | S-(1-phenyltetrazol-5-yl) N-[[2-[furan-2-yl-[4-(methanesulfonamido)phenyl]methoxy]-5-nitrophenyl]methyl]-N-propan-2-ylcarbamothioate |
| SMILES | CC(C)N(Cc1cc([N+](=O)[O-])ccc1OC(c1ccc(NS(C)(=O)=O)cc1)c1ccco1)C(=O)Sc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C30H29N7O7S2/c1-20(2)35(30(38)45-29-31-33-34-36(29)24-8-5-4-6-9-24)19-22-18-25(37(39)40)15-16-26(22)44-28(27-10-7-17-43-27)21-11-13-23(14-12-21)32-46(3,41)42/h4-18,20,28,32H,19H2,1-3H3 |
| InChIKey | ZRVLRSDVYQJMJO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 175.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.74 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|