C26H25ClN6O6S2 — CID 20737265
S-(1-phenyltetrazol-5-yl) N-[[2-[2-(4-chlorophenyl)sulfonylethoxy]-5-nitrophenyl]methyl]-N-propan-2-ylcarbamothioate (PubChem CID 20737265) has the molecular formula C26H25ClN6O6S2 and a molecular weight of 617.11 g/mol. Its IUPAC name is S-(1-phenyltetrazol-5-yl) N-[[2-[2-(4-chlorophenyl)sulfonylethoxy]-5-nitrophenyl]methyl]-N-propan-2-ylcarbamothioate.
| Compound Name | S-(1-phenyltetrazol-5-yl) N-[[2-[2-(4-chlorophenyl)sulfonylethoxy]-5-nitrophenyl]methyl]-N-propan-2-ylcarbamothioate |
|---|---|
| PubChem CID | 20737265 |
| Molecular Formula | C26H25ClN6O6S2 |
| Molecular Weight | 617.11 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | S-(1-phenyltetrazol-5-yl) N-[[2-[2-(4-chlorophenyl)sulfonylethoxy]-5-nitrophenyl]methyl]-N-propan-2-ylcarbamothioate |
| SMILES | CC(C)N(Cc1cc([N+](=O)[O-])ccc1OCCS(=O)(=O)c1ccc(Cl)cc1)C(=O)Sc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C26H25ClN6O6S2/c1-18(2)31(26(34)40-25-28-29-30-32(25)21-6-4-3-5-7-21)17-19-16-22(33(35)36)10-13-24(19)39-14-15-41(37,38)23-11-8-20(27)9-12-23/h3-13,16,18H,14-15,17H2,1-2H3 |
| InChIKey | LCNURIPUDOZXHH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 150.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.11 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|