About 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane
2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane (PubChem CID 70948958) has the molecular formula C12H18F2O2
and a molecular weight of 232.27 g/mol. Its IUPAC name is 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane |
| PubChem CID | 70948958 |
| Molecular Formula | C12H18F2O2 |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane |
| SMILES | CC1COC(C2CCC(=C(F)F)CC2)OC1 |
| InChI | InChI=1S/C12H18F2O2/c1-8-6-15-12(16-7-8)10-4-2-9(3-5-10)11(13)14/h8,10,12H,2-7H2,1H3 |
| InChIKey | BGBHRISJDSCGKZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane?
The IUPAC name of 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane (CID 70948958) is 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane.
What is the SMILES notation for 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane?
The canonical SMILES for 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane is CC1COC(C2CCC(=C(F)F)CC2)OC1.
What is the InChIKey of 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane?
The InChIKey is BGBHRISJDSCGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2O2/c1-8-6-15-12(16-7-8)10-4-2-9(3-5-10)11(13)14/h8,10,12H,2-7H2,1H3.
What are the key properties of 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane?
2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane has a molecular weight of 232.27 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(difluoromethylidene)cyclohexyl]-5-methyl-1,3-dioxane is sourced from PubChem (CID 70948958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).