C19H20N2O4S2 — CID 70951142
3-N-cyclohexa-1,3-dien-1-yl-3-N-methyl-1-N-phenylbenzene-1,3-disulfonamide (PubChem CID 70951142) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-N-cyclohexa-1,3-dien-1-yl-3-N-methyl-1-N-phenylbenzene-1,3-disulfonamide.
| Compound Name | 3-N-cyclohexa-1,3-dien-1-yl-3-N-methyl-1-N-phenylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 70951142 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 3-N-cyclohexa-1,3-dien-1-yl-3-N-methyl-1-N-phenylbenzene-1,3-disulfonamide |
| SMILES | CN(C1=CC=CCC1)S(=O)(=O)c1cccc(S(=O)(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O4S2/c1-21(17-11-6-3-7-12-17)27(24,25)19-14-8-13-18(15-19)26(22,23)20-16-9-4-2-5-10-16/h2-6,8-11,13-15,20H,7,12H2,1H3 |
| InChIKey | ALQPPFKPLMOTJU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |