C20H29N3O10 — CID 70953113
2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-5-methyloxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate (PubChem CID 70953113) has the molecular formula C20H29N3O10 and a molecular weight of 471.46 g/mol. Its IUPAC name is 2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-5-methyloxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate.
| Compound Name | 2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-5-methyloxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate |
|---|---|
| PubChem CID | 70953113 |
| Molecular Formula | C20H29N3O10 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-5-methyloxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate |
| SMILES | CC(=O)Nc1ccn([C@@H]2O[C@H](C)CC2OC(OCCOC(C)=O)OCCOC(C)=O)c(=O)n1 |
| InChI | InChI=1S/C20H29N3O10/c1-12-11-16(18(32-12)23-6-5-17(21-13(2)24)22-19(23)27)33-20(30-9-7-28-14(3)25)31-10-8-29-15(4)26/h5-6,12,16,18,20H,7-11H2,1-4H3,(H,21,22,24,27)/t12-,16?,18-/m1/s1 |
| InChIKey | DPFQITCRPOEAGH-VALIOXDKSA-N |
| XLogP | 0.34 |
| TPSA | 153.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|