C20H29N3O12 — CID 70953080
2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate (PubChem CID 70953080) has the molecular formula C20H29N3O12 and a molecular weight of 503.46 g/mol. Its IUPAC name is 2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate.
| Compound Name | 2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate |
|---|---|
| PubChem CID | 70953080 |
| Molecular Formula | C20H29N3O12 |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate |
| SMILES | CC(=O)Nc1ccn([C@@H]2O[C@H](CO)C(O)C2OC(OCCOC(C)=O)OCCOC(C)=O)c(=O)n1 |
| InChI | InChI=1S/C20H29N3O12/c1-11(25)21-15-4-5-23(19(29)22-15)18-17(16(28)14(10-24)34-18)35-20(32-8-6-30-12(2)26)33-9-7-31-13(3)27/h4-5,14,16-18,20,24,28H,6-10H2,1-3H3,(H,21,22,25,29)/t14-,16?,17?,18-/m1/s1 |
| InChIKey | PHKNABZQACVNRT-AGERRDQYSA-N |
| XLogP | -1.72 |
| TPSA | 193.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|