C21H26ClN3O8 — CID 71342205
N-[1-[3-[1-(2-chloroethoxy)ethoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-4-methoxybenzamide (PubChem CID 71342205) has the molecular formula C21H26ClN3O8 and a molecular weight of 483.91 g/mol. Its IUPAC name is N-[1-[3-[1-(2-chloroethoxy)ethoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-4-methoxybenzamide.
| Compound Name | N-[1-[3-[1-(2-chloroethoxy)ethoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 71342205 |
| Molecular Formula | C21H26ClN3O8 |
| Molecular Weight | 483.91 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N-[1-[3-[1-(2-chloroethoxy)ethoxy]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccn(C3OC(CO)C(O)C3OC(C)OCCCl)c(=O)n2)cc1 |
| InChI | InChI=1S/C21H26ClN3O8/c1-12(31-10-8-22)32-18-17(27)15(11-26)33-20(18)25-9-7-16(24-21(25)29)23-19(28)13-3-5-14(30-2)6-4-13/h3-7,9,12,15,17-18,20,26-27H,8,10-11H2,1-2H3,(H,23,24,28,29) |
| InChIKey | RLNBIGDRDZOFMJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.91 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|