C26H43N3O12Si — CID 70956038
2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate (PubChem CID 70956038) has the molecular formula C26H43N3O12Si and a molecular weight of 617.73 g/mol. Its IUPAC name is 2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate.
| Compound Name | 2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate |
|---|---|
| PubChem CID | 70956038 |
| Molecular Formula | C26H43N3O12Si |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | 2-[[(2R,5R)-2-(4-acetamido-2-oxopyrimidin-1-yl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-3-yl]oxy-(2-acetyloxyethoxy)methoxy]ethyl acetate |
| SMILES | CC(=O)Nc1ccn([C@@H]2O[C@H](CO)C(O[Si](C)(C)C(C)(C)C)C2OC(OCCOC(C)=O)OCCOC(C)=O)c(=O)n1 |
| InChI | InChI=1S/C26H43N3O12Si/c1-16(31)27-20-9-10-29(24(34)28-20)23-22(21(19(15-30)39-23)41-42(7,8)26(4,5)6)40-25(37-13-11-35-17(2)32)38-14-12-36-18(3)33/h9-10,19,21-23,25,30H,11-15H2,1-8H3,(H,27,28,31,34)/t19-,21?,22?,23-/m1/s1 |
| InChIKey | ITEDEEKTFQFLTN-SDXIKQIGSA-N |
| XLogP | 1.31 |
| TPSA | 182.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|