C31H61N4O6PSi2 — CID 11767570
N-[1-[(2R,3R,4R,5S)-5-[(S)-amino(dibutylphosphoryl)methyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 11767570) has the molecular formula C31H61N4O6PSi2 and a molecular weight of 673.00 g/mol. Its IUPAC name is N-[1-[(2R,3R,4R,5S)-5-[(S)-amino(dibutylphosphoryl)methyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[(2R,3R,4R,5S)-5-[(S)-amino(dibutylphosphoryl)methyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 11767570 |
| Molecular Formula | C31H61N4O6PSi2 |
| Molecular Weight | 673.00 g/mol |
| Exact Mass | 672.39 |
| IUPAC Name | N-[1-[(2R,3R,4R,5S)-5-[(S)-amino(dibutylphosphoryl)methyl]-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CCCCP(=O)(CCCC)[C@H](N)[C@H]1O[C@@H](n2ccc(NC(C)=O)nc2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H61N4O6PSi2/c1-14-16-20-42(38,21-17-15-2)27(32)25-24(40-43(10,11)30(4,5)6)26(41-44(12,13)31(7,8)9)28(39-25)35-19-18-23(33-22(3)36)34-29(35)37/h18-19,24-28H,14-17,20-21,32H2,1-13H3,(H,33,34,36,37)/t24-,25+,26-,27+,28-/m1/s1 |
| InChIKey | PXQKWISKBMWQCE-YTZCDUBRSA-N |
| XLogP | 7.13 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.00 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|