C24H35N2O2P — CID 70962419
1-[(1S,2R,11S,13R,14S,17R,18S)-17-hydroxy-2,11,18-trimethyl-7-(phosphanylmethyl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]ethanone (PubChem CID 70962419) has the molecular formula C24H35N2O2P and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-[(1S,2R,11S,13R,14S,17R,18S)-17-hydroxy-2,11,18-trimethyl-7-(phosphanylmethyl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]ethanone.
| Compound Name | 1-[(1S,2R,11S,13R,14S,17R,18S)-17-hydroxy-2,11,18-trimethyl-7-(phosphanylmethyl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]ethanone |
|---|---|
| PubChem CID | 70962419 |
| Molecular Formula | C24H35N2O2P |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 1-[(1S,2R,11S,13R,14S,17R,18S)-17-hydroxy-2,11,18-trimethyl-7-(phosphanylmethyl)-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C[C@H](C)C4=Cc5c(cnn5CP)C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H35N2O2P/c1-14-9-17-18(5-7-23(4)19(17)6-8-24(23,28)15(2)27)22(3)11-16-12-25-26(13-29)21(16)10-20(14)22/h10,12,14,17-19,28H,5-9,11,13,29H2,1-4H3/t14-,17+,18-,19-,22+,23-,24-/m0/s1 |
| InChIKey | YHGJYVSEDDNOTO-USTFCYDESA-N |
| XLogP | 4.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|