C22H35N7O8 — CID 70963227
2-[(2-amino-4-methylpentanoyl)amino]-5-[3-azido-2-[1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]butoxy]-5-oxopentanoic acid (PubChem CID 70963227) has the molecular formula C22H35N7O8 and a molecular weight of 525.56 g/mol. Its IUPAC name is 2-[(2-amino-4-methylpentanoyl)amino]-5-[3-azido-2-[1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]butoxy]-5-oxopentanoic acid.
| Compound Name | 2-[(2-amino-4-methylpentanoyl)amino]-5-[3-azido-2-[1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]butoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70963227 |
| Molecular Formula | C22H35N7O8 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 2-[(2-amino-4-methylpentanoyl)amino]-5-[3-azido-2-[1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]butoxy]-5-oxopentanoic acid |
| SMILES | Cc1cn(C(C)OC(COC(=O)CCC(NC(=O)C(N)CC(C)C)C(=O)O)C(C)N=[N+]=[N-])c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H35N7O8/c1-11(2)8-15(23)20(32)25-16(21(33)34)6-7-18(30)36-10-17(13(4)27-28-24)37-14(5)29-9-12(3)19(31)26-22(29)35/h9,11,13-17H,6-8,10,23H2,1-5H3,(H,25,32)(H,33,34)(H,26,31,35) |
| InChIKey | WSAYJUVGYKBOFW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 231.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|