C25H24ClFN4O — CID 70965542
(13Z)-5-chloro-6-fluoro-10,19-dimethyl-17-oxa-2,10,22-triazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(25),3,5,7,13,18(26),19,21,23-nonaene-24-carbonitrile (PubChem CID 70965542) has the molecular formula C25H24ClFN4O and a molecular weight of 450.95 g/mol. Its IUPAC name is (13Z)-5-chloro-6-fluoro-10,19-dimethyl-17-oxa-2,10,22-triazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(25),3,5,7,13,18(26),19,21,23-nonaene-24-carbonitrile.
| Compound Name | (13Z)-5-chloro-6-fluoro-10,19-dimethyl-17-oxa-2,10,22-triazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(25),3,5,7,13,18(26),19,21,23-nonaene-24-carbonitrile |
|---|---|
| PubChem CID | 70965542 |
| Molecular Formula | C25H24ClFN4O |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (13Z)-5-chloro-6-fluoro-10,19-dimethyl-17-oxa-2,10,22-triazatetracyclo[16.6.2.03,8.021,25]hexacosa-1(25),3,5,7,13,18(26),19,21,23-nonaene-24-carbonitrile |
| SMILES | Cc1cc2ncc(C#N)c3c2cc1OCC/C=C\CCN(C)Cc1cc(F)c(Cl)cc1N3 |
| InChI | InChI=1S/C25H24ClFN4O/c1-16-9-23-19-11-24(16)32-8-6-4-3-5-7-31(2)15-17-10-21(27)20(26)12-22(17)30-25(19)18(13-28)14-29-23/h3-4,9-12,14,30H,5-8,15H2,1-2H3/b4-3- |
| InChIKey | CKEKVMJPDAZYRP-ARJAWSKDSA-N |
| XLogP | 6.11 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|