C12H16N2O — CID 70965583
(3aS,9bS)-1-methyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-h]isoquinolin-5-ol (PubChem CID 70965583) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (3aS,9bS)-1-methyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-h]isoquinolin-5-ol.
| Compound Name | (3aS,9bS)-1-methyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-h]isoquinolin-5-ol |
|---|---|
| PubChem CID | 70965583 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (3aS,9bS)-1-methyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-h]isoquinolin-5-ol |
| SMILES | CN1CC[C@H]2CC(O)c3ccncc3[C@H]21 |
| InChI | InChI=1S/C12H16N2O/c1-14-5-3-8-6-11(15)9-2-4-13-7-10(9)12(8)14/h2,4,7-8,11-12,15H,3,5-6H2,1H3/t8-,11?,12-/m0/s1 |
| InChIKey | IEAOWIYYEASIAE-XWMUTSTRSA-N |
| XLogP | 1.51 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |