C14H17NO — CID 142041822
8-[(3E)-penta-1,3-dien-3-yl]-5,6,7,8-tetrahydroisoquinolin-5-ol (PubChem CID 142041822) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 8-[(3E)-penta-1,3-dien-3-yl]-5,6,7,8-tetrahydroisoquinolin-5-ol.
| Compound Name | 8-[(3E)-penta-1,3-dien-3-yl]-5,6,7,8-tetrahydroisoquinolin-5-ol |
|---|---|
| PubChem CID | 142041822 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 8-[(3E)-penta-1,3-dien-3-yl]-5,6,7,8-tetrahydroisoquinolin-5-ol |
| SMILES | C=C/C(=C\C)C1CCC(O)c2ccncc21 |
| InChI | InChI=1S/C14H17NO/c1-3-10(4-2)11-5-6-14(16)12-7-8-15-9-13(11)12/h3-4,7-9,11,14,16H,1,5-6H2,2H3/b10-4+ |
| InChIKey | AOZJIZYOPMDUHR-ONNFQVAWSA-N |
| XLogP | 3.12 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|