C32H50N8O3 — CID 70965801
N-[1-[[1-[[(1S)-1-azidopentyl]amino]-3-(1-methylindol-3-yl)-1-oxopropan-2-yl]amino]-4,4-dimethyl-1-oxopentan-2-yl]-2,6-dimethylpiperidine-1-carboxamide (PubChem CID 70965801) has the molecular formula C32H50N8O3 and a molecular weight of 594.81 g/mol. Its IUPAC name is N-[1-[[1-[[(1S)-1-azidopentyl]amino]-3-(1-methylindol-3-yl)-1-oxopropan-2-yl]amino]-4,4-dimethyl-1-oxopentan-2-yl]-2,6-dimethylpiperidine-1-carboxamide.
| Compound Name | N-[1-[[1-[[(1S)-1-azidopentyl]amino]-3-(1-methylindol-3-yl)-1-oxopropan-2-yl]amino]-4,4-dimethyl-1-oxopentan-2-yl]-2,6-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 70965801 |
| Molecular Formula | C32H50N8O3 |
| Molecular Weight | 594.81 g/mol |
| Exact Mass | 594.40 |
| IUPAC Name | N-[1-[[1-[[(1S)-1-azidopentyl]amino]-3-(1-methylindol-3-yl)-1-oxopropan-2-yl]amino]-4,4-dimethyl-1-oxopentan-2-yl]-2,6-dimethylpiperidine-1-carboxamide |
| SMILES | CCCC[C@H](N=[N+]=[N-])NC(=O)C(Cc1cn(C)c2ccccc12)NC(=O)C(CC(C)(C)C)NC(=O)N1C(C)CCCC1C |
| InChI | InChI=1S/C32H50N8O3/c1-8-9-17-28(37-38-33)36-29(41)25(18-23-20-39(7)27-16-11-10-15-24(23)27)34-30(42)26(19-32(4,5)6)35-31(43)40-21(2)13-12-14-22(40)3/h10-11,15-16,20-22,25-26,28H,8-9,12-14,17-19H2,1-7H3,(H,34,42)(H,35,43)(H,36,41)/t21?,22?,25?,26?,28-/m0/s1 |
| InChIKey | LRPDHJHUAGHVAC-UZQKDVTISA-N |
| XLogP | 5.93 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|