C28H37NO6 — CID 70966165
ethyl (1S,5R,14R,15R)-15-[(2R)-2-hydroxy-3,3-dimethylbutan-2-yl]-10,14-dimethoxy-12-oxa-4-azahexacyclo[9.6.1.114,16.01,13.05,17.07,18]nonadeca-7(18),8,10,16-tetraene-4-carboxylate (PubChem CID 70966165) has the molecular formula C28H37NO6 and a molecular weight of 483.61 g/mol. Its IUPAC name is ethyl (1S,5R,14R,15R)-15-[(2R)-2-hydroxy-3,3-dimethylbutan-2-yl]-10,14-dimethoxy-12-oxa-4-azahexacyclo[9.6.1.114,16.01,13.05,17.07,18]nonadeca-7(18),8,10,16-tetraene-4-carboxylate.
| Compound Name | ethyl (1S,5R,14R,15R)-15-[(2R)-2-hydroxy-3,3-dimethylbutan-2-yl]-10,14-dimethoxy-12-oxa-4-azahexacyclo[9.6.1.114,16.01,13.05,17.07,18]nonadeca-7(18),8,10,16-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 70966165 |
| Molecular Formula | C28H37NO6 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | ethyl (1S,5R,14R,15R)-15-[(2R)-2-hydroxy-3,3-dimethylbutan-2-yl]-10,14-dimethoxy-12-oxa-4-azahexacyclo[9.6.1.114,16.01,13.05,17.07,18]nonadeca-7(18),8,10,16-tetraene-4-carboxylate |
| SMILES | CCOC(=O)N1CC[C@@]23C4=C5C[C@](OC)(C2Oc2c(OC)ccc(c23)C[C@H]41)[C@H]5[C@@](C)(O)C(C)(C)C |
| InChI | InChI=1S/C28H37NO6/c1-8-34-24(30)29-12-11-27-19-15-9-10-18(32-6)21(19)35-23(27)28(33-7)14-16(20(27)17(29)13-15)22(28)26(5,31)25(2,3)4/h9-10,17,22-23,31H,8,11-14H2,1-7H3/t17-,22-,23?,26-,27-,28-/m1/s1 |
| InChIKey | ZLVIICXYPQWNBV-GKTIIKBQSA-N |
| XLogP | 3.99 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|