C9H12F2N2O2S — CID 70968206
5-[(1R)-1-aminoethyl]-1,3-difluoro-2-[(sulfinoamino)methyl]benzene (PubChem CID 70968206) has the molecular formula C9H12F2N2O2S and a molecular weight of 250.27 g/mol. Its IUPAC name is 5-[(1R)-1-aminoethyl]-1,3-difluoro-2-[(sulfinoamino)methyl]benzene.
| Compound Name | 5-[(1R)-1-aminoethyl]-1,3-difluoro-2-[(sulfinoamino)methyl]benzene |
|---|---|
| PubChem CID | 70968206 |
| Molecular Formula | C9H12F2N2O2S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-[(1R)-1-aminoethyl]-1,3-difluoro-2-[(sulfinoamino)methyl]benzene |
| SMILES | C[C@@H](N)c1cc(F)c(CNS(=O)O)c(F)c1 |
| InChI | InChI=1S/C9H12F2N2O2S/c1-5(12)6-2-8(10)7(9(11)3-6)4-13-16(14)15/h2-3,5,13H,4,12H2,1H3,(H,14,15)/t5-/m1/s1 |
| InChIKey | WCUNBMNHGOFINU-RXMQYKEDSA-N |
| XLogP | 1.21 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|