C9H11N3O3S — CID 70971996
methyl 2-[[(E)-2,3-diaminoprop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 70971996) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is methyl 2-[[(E)-2,3-diaminoprop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[(E)-2,3-diaminoprop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 70971996 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | methyl 2-[[(E)-2,3-diaminoprop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)/C(N)=C\N |
| InChI | InChI=1S/C9H11N3O3S/c1-15-9(14)5-2-3-16-8(5)12-7(13)6(11)4-10/h2-4H,10-11H2,1H3,(H,12,13)/b6-4+ |
| InChIKey | IOISJSOOBATEJL-GQCTYLIASA-N |
| XLogP | 0.23 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|