C26H21FN4O2S — CID 70973557
N-[5-[[3-(fluoromethyl)benzoyl]-methylamino]-2-methylphenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide (PubChem CID 70973557) has the molecular formula C26H21FN4O2S and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[5-[[3-(fluoromethyl)benzoyl]-methylamino]-2-methylphenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide.
| Compound Name | N-[5-[[3-(fluoromethyl)benzoyl]-methylamino]-2-methylphenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 70973557 |
| Molecular Formula | C26H21FN4O2S |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[5-[[3-(fluoromethyl)benzoyl]-methylamino]-2-methylphenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
| SMILES | Cc1ccc(N(C)C(=O)c2cccc(CF)c2)cc1NC(=O)c1cc2cnc3[nH]ccc3c2s1 |
| InChI | InChI=1S/C26H21FN4O2S/c1-15-6-7-19(31(2)26(33)17-5-3-4-16(10-17)13-27)12-21(15)30-25(32)22-11-18-14-29-24-20(8-9-28-24)23(18)34-22/h3-12,14H,13H2,1-2H3,(H,28,29)(H,30,32) |
| InChIKey | PQCFAJACDVCORA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |