C21H17F3IN5O3 — CID 70974086
2-acetamido-4-[4-[[2-iodo-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 70974086) has the molecular formula C21H17F3IN5O3 and a molecular weight of 571.30 g/mol. Its IUPAC name is 2-acetamido-4-[4-[[2-iodo-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-acetamido-4-[4-[[2-iodo-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 70974086 |
| Molecular Formula | C21H17F3IN5O3 |
| Molecular Weight | 571.30 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | 2-acetamido-4-[4-[[2-iodo-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | CC(=O)Nc1[nH]cc(-c2ccc(NC(=O)Nc3cc(C(F)(F)F)ccc3I)cc2)c1C(N)=O |
| InChI | InChI=1S/C21H17F3IN5O3/c1-10(31)28-19-17(18(26)32)14(9-27-19)11-2-5-13(6-3-11)29-20(33)30-16-8-12(21(22,23)24)4-7-15(16)25/h2-9,27H,1H3,(H2,26,32)(H,28,31)(H2,29,30,33) |
| InChIKey | MJXMEMVDVGTSIH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|