C15H11ClF3N3OS — CID 66553555
1-(4-carbamothioylphenyl)-3-[2-chloro-4-(trifluoromethyl)phenyl]urea (PubChem CID 66553555) has the molecular formula C15H11ClF3N3OS and a molecular weight of 373.79 g/mol. Its IUPAC name is 1-(4-carbamothioylphenyl)-3-[2-chloro-4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-carbamothioylphenyl)-3-[2-chloro-4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 66553555 |
| Molecular Formula | C15H11ClF3N3OS |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 1-(4-carbamothioylphenyl)-3-[2-chloro-4-(trifluoromethyl)phenyl]urea |
| SMILES | NC(=S)c1ccc(NC(=O)Nc2ccc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C15H11ClF3N3OS/c16-11-7-9(15(17,18)19)3-6-12(11)22-14(23)21-10-4-1-8(2-5-10)13(20)24/h1-7H,(H2,20,24)(H2,21,22,23) |
| InChIKey | HVTIFMKSUGIJBF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|