C22H27N3O — CID 70975232
(2S)-4-benzyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazine-2-carboxamide (PubChem CID 70975232) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is (2S)-4-benzyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazine-2-carboxamide.
| Compound Name | (2S)-4-benzyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 70975232 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | (2S)-4-benzyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazine-2-carboxamide |
| SMILES | O=C(NC1CCCc2ccccc21)[C@@H]1CN(Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C22H27N3O/c26-22(24-20-12-6-10-18-9-4-5-11-19(18)20)21-16-25(14-13-23-21)15-17-7-2-1-3-8-17/h1-5,7-9,11,20-21,23H,6,10,12-16H2,(H,24,26)/t20?,21-/m0/s1 |
| InChIKey | TZZXFCOMNNEZGS-LBAQZLPGSA-N |
| XLogP | 2.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |