C22H29N3O — CID 143311626
(2S)-4-benzyl-N-[(1R)-1,2,3,4,5,6-hexahydronaphthalen-1-yl]piperazine-2-carboxamide (PubChem CID 143311626) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is (2S)-4-benzyl-N-[(1R)-1,2,3,4,5,6-hexahydronaphthalen-1-yl]piperazine-2-carboxamide.
| Compound Name | (2S)-4-benzyl-N-[(1R)-1,2,3,4,5,6-hexahydronaphthalen-1-yl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 143311626 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (2S)-4-benzyl-N-[(1R)-1,2,3,4,5,6-hexahydronaphthalen-1-yl]piperazine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC2=C1C=CCC2)[C@@H]1CN(Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C22H29N3O/c26-22(24-20-12-6-10-18-9-4-5-11-19(18)20)21-16-25(14-13-23-21)15-17-7-2-1-3-8-17/h1-3,5,7-8,11,20-21,23H,4,6,9-10,12-16H2,(H,24,26)/t20-,21+/m1/s1 |
| InChIKey | WBCVYGUKFZBZAR-RTWAWAEBSA-N |
| XLogP | 2.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |